C17H24FN — CID 83067007
N-(3-ethylcyclohexyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 83067007) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is N-(3-ethylcyclohexyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(3-ethylcyclohexyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 83067007 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-(3-ethylcyclohexyl)-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCC1CCCC(NC2CCc3c(F)cccc32)C1 |
| InChI | InChI=1S/C17H24FN/c1-2-12-5-3-6-13(11-12)19-17-10-9-14-15(17)7-4-8-16(14)18/h4,7-8,12-13,17,19H,2-3,5-6,9-11H2,1H3 |
| InChIKey | VCWQVWKCSALIEK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |