C15H21F2N — CID 64742190
N-[(2,6-difluorophenyl)methyl]-3-ethylcyclohexan-1-amine (PubChem CID 64742190) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-3-ethylcyclohexan-1-amine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-3-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64742190 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-3-ethylcyclohexan-1-amine |
| SMILES | CCC1CCCC(NCc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H21F2N/c1-2-11-5-3-6-12(9-11)18-10-13-14(16)7-4-8-15(13)17/h4,7-8,11-12,18H,2-3,5-6,9-10H2,1H3 |
| InChIKey | FWXCSWOWUXPDKT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |