C16H22FN — CID 83065507
N-[(1R)-1-cyclopentylethyl]-4-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 83065507) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[(1R)-1-cyclopentylethyl]-4-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(1R)-1-cyclopentylethyl]-4-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 83065507 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[(1R)-1-cyclopentylethyl]-4-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[C@@H](NC1CCc2c(F)cccc21)C1CCCC1 |
| InChI | InChI=1S/C16H22FN/c1-11(12-5-2-3-6-12)18-16-10-9-13-14(16)7-4-8-15(13)17/h4,7-8,11-12,16,18H,2-3,5-6,9-10H2,1H3/t11-,16?/m1/s1 |
| InChIKey | BZMIZPGAKORSPM-ZVDHGWRTSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |