C15H21NO — CID 115717656
1-(1-cyclobutylethylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 115717656) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(1-cyclobutylethylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(1-cyclobutylethylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 115717656 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(1-cyclobutylethylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC(NC1CCc2c(O)cccc21)C1CCC1 |
| InChI | InChI=1S/C15H21NO/c1-10(11-4-2-5-11)16-14-9-8-13-12(14)6-3-7-15(13)17/h3,6-7,10-11,14,16-17H,2,4-5,8-9H2,1H3 |
| InChIKey | MFJXJQFMDCYOIS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |