C16H19NO2 — CID 43685026
1-[1-(5-methylfuran-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 43685026) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-[1-(5-methylfuran-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[1-(5-methylfuran-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43685026 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-[1-(5-methylfuran-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(C(C)NC2CCc3c(O)cccc32)o1 |
| InChI | InChI=1S/C16H19NO2/c1-10-6-9-16(19-10)11(2)17-14-8-7-13-12(14)4-3-5-15(13)18/h3-6,9,11,14,17-18H,7-8H2,1-2H3 |
| InChIKey | UOSWTGXTZQVSDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |