C14H21NO — CID 43636908
1-(pentan-3-ylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 43636908) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(pentan-3-ylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(pentan-3-ylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43636908 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(pentan-3-ylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | CCC(CC)NC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C14H21NO/c1-3-10(4-2)15-13-9-8-12-11(13)6-5-7-14(12)16/h5-7,10,13,15-16H,3-4,8-9H2,1-2H3 |
| InChIKey | TWYFQPXQGYKLOG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |