C15H21NO2 — CID 43637115
1-[1-(oxolan-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 43637115) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[1-(oxolan-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[1-(oxolan-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43637115 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[1-(oxolan-2-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC(NC1CCc2c(O)cccc21)C1CCCO1 |
| InChI | InChI=1S/C15H21NO2/c1-10(15-6-3-9-18-15)16-13-8-7-12-11(13)4-2-5-14(12)17/h2,4-5,10,13,15-17H,3,6-9H2,1H3 |
| InChIKey | ZADRKVLVYQRCGX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |