C14H12ClFN2 — CID 83066640
2-chloro-N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)pyridin-3-amine (PubChem CID 83066640) has the molecular formula C14H12ClFN2 and a molecular weight of 262.72 g/mol. Its IUPAC name is 2-chloro-N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)pyridin-3-amine.
| Compound Name | 2-chloro-N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 83066640 |
| Molecular Formula | C14H12ClFN2 |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-chloro-N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)pyridin-3-amine |
| SMILES | Fc1cccc2c1CCC2Nc1cccnc1Cl |
| InChI | InChI=1S/C14H12ClFN2/c15-14-13(5-2-8-17-14)18-12-7-6-9-10(12)3-1-4-11(9)16/h1-5,8,12,18H,6-7H2 |
| InChIKey | VFMKOUHQFKFNRA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|