C17H26OSi — CID 134980286
tert-butyl-dimethyl-[(4-methylidene-2,3-dihydro-1H-naphthalen-1-yl)oxy]silane (PubChem CID 134980286) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4-methylidene-2,3-dihydro-1H-naphthalen-1-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4-methylidene-2,3-dihydro-1H-naphthalen-1-yl)oxy]silane |
|---|---|
| PubChem CID | 134980286 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | tert-butyl-dimethyl-[(4-methylidene-2,3-dihydro-1H-naphthalen-1-yl)oxy]silane |
| SMILES | C=C1CCC(O[Si](C)(C)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H26OSi/c1-13-11-12-16(15-10-8-7-9-14(13)15)18-19(5,6)17(2,3)4/h7-10,16H,1,11-12H2,2-6H3 |
| InChIKey | HGDJEASGCLSFJS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|