C20H30O2Si — CID 123160452
1-[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]pent-4-en-1-one (PubChem CID 123160452) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is 1-[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]pent-4-en-1-one.
| Compound Name | 1-[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 123160452 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)c1cccc2c1CCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30O2Si/c1-7-8-12-18(21)16-10-9-11-17-15(16)13-14-19(17)22-23(5,6)20(2,3)4/h7,9-11,19H,1,8,12-14H2,2-6H3 |
| InChIKey | WLUIBLDBNXQKCS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|