C20H32O2Si — CID 67812161
[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-cyclobutylmethanol (PubChem CID 67812161) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-cyclobutylmethanol.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-cyclobutylmethanol |
|---|---|
| PubChem CID | 67812161 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-cyclobutylmethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCc2c1cccc2C(O)C1CCC1 |
| InChI | InChI=1S/C20H32O2Si/c1-20(2,3)23(4,5)22-18-13-12-15-16(18)10-7-11-17(15)19(21)14-8-6-9-14/h7,10-11,14,18-19,21H,6,8-9,12-13H2,1-5H3 |
| InChIKey | HAKOCGPWXYGFIW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|