C22H38O3Si — CID 175133450
[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-(2,3-dimethylbutan-2-yloxy)methanol (PubChem CID 175133450) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-(2,3-dimethylbutan-2-yloxy)methanol.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-(2,3-dimethylbutan-2-yloxy)methanol |
|---|---|
| PubChem CID | 175133450 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-4-yl]-(2,3-dimethylbutan-2-yloxy)methanol |
| SMILES | CC(C)C(C)(C)OC(O)c1cccc2c1CCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-15(2)22(6,7)24-20(23)18-12-10-11-17-16(18)13-14-19(17)25-26(8,9)21(3,4)5/h10-12,15,19-20,23H,13-14H2,1-9H3 |
| InChIKey | OYXJUVIPVRQKEP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|