C16H25NO2Si — CID 150629221
N-[[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-5-yl]methylidene]hydroxylamine (PubChem CID 150629221) has the molecular formula C16H25NO2Si and a molecular weight of 291.47 g/mol. Its IUPAC name is N-[[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-5-yl]methylidene]hydroxylamine.
| Compound Name | N-[[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 150629221 |
| Molecular Formula | C16H25NO2Si |
| Molecular Weight | 291.47 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[1-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-5-yl]methylidene]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCc2cc(C=NO)ccc21 |
| InChI | InChI=1S/C16H25NO2Si/c1-16(2,3)20(4,5)19-15-9-7-13-10-12(11-17-18)6-8-14(13)15/h6,8,10-11,15,18H,7,9H2,1-5H3 |
| InChIKey | IXNJQCLJVNXVNA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|