C22H36O2Si — CID 123396288
tert-butyl-[[4-(4-ethyl-3,3-dimethyloxetan-2-yl)-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane (PubChem CID 123396288) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is tert-butyl-[[4-(4-ethyl-3,3-dimethyloxetan-2-yl)-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-(4-ethyl-3,3-dimethyloxetan-2-yl)-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 123396288 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl-[[4-(4-ethyl-3,3-dimethyloxetan-2-yl)-2,3-dihydro-1H-inden-1-yl]oxy]-dimethylsilane |
| SMILES | CCC1OC(c2cccc3c2CCC3O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C22H36O2Si/c1-9-19-22(5,6)20(23-19)17-12-10-11-16-15(17)13-14-18(16)24-25(7,8)21(2,3)4/h10-12,18-20H,9,13-14H2,1-8H3 |
| InChIKey | XUEAGOHCMFSWCH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|