C22H27ClN2OSi — CID 123649519
1-[tert-butyl(dimethyl)silyl]oxy-4-[(6-chloro-3-pyridinyl)methyl]-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 123649519) has the molecular formula C22H27ClN2OSi and a molecular weight of 399.01 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-4-[(6-chloro-3-pyridinyl)methyl]-2,3-dihydro-1H-indene-5-carbonitrile.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[(6-chloro-3-pyridinyl)methyl]-2,3-dihydro-1H-indene-5-carbonitrile |
|---|---|
| PubChem CID | 123649519 |
| Molecular Formula | C22H27ClN2OSi |
| Molecular Weight | 399.01 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-4-[(6-chloro-3-pyridinyl)methyl]-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCc2c1ccc(C#N)c2Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H27ClN2OSi/c1-22(2,3)27(4,5)26-20-10-9-17-18(20)8-7-16(13-24)19(17)12-15-6-11-21(23)25-14-15/h6-8,11,14,20H,9-10,12H2,1-5H3 |
| InChIKey | IXJXLQJKWUKHHH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.01 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|