C22H43ClN2O2Si2 — CID 123495983
2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(6-chloro-3-pyridinyl)methyl]ethanamine (PubChem CID 123495983) has the molecular formula C22H43ClN2O2Si2 and a molecular weight of 459.22 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(6-chloro-3-pyridinyl)methyl]ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(6-chloro-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 123495983 |
| Molecular Formula | C22H43ClN2O2Si2 |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(6-chloro-3-pyridinyl)methyl]ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H43ClN2O2Si2/c1-21(2,3)28(7,8)26-15-13-25(18-19-11-12-20(23)24-17-19)14-16-27-29(9,10)22(4,5)6/h11-12,17H,13-16,18H2,1-10H3 |
| InChIKey | XDAHRNVDDMSZFP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|