C19H24Cl2N4O2 — CID 87330988
tert-butyl N-[2-[bis[(6-chloro-3-pyridinyl)methyl]amino]ethyl]carbamate (PubChem CID 87330988) has the molecular formula C19H24Cl2N4O2 and a molecular weight of 411.33 g/mol. Its IUPAC name is tert-butyl N-[2-[bis[(6-chloro-3-pyridinyl)methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[bis[(6-chloro-3-pyridinyl)methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 87330988 |
| Molecular Formula | C19H24Cl2N4O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | tert-butyl N-[2-[bis[(6-chloro-3-pyridinyl)methyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1ccc(Cl)nc1)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H24Cl2N4O2/c1-19(2,3)27-18(26)22-8-9-25(12-14-4-6-16(20)23-10-14)13-15-5-7-17(21)24-11-15/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,22,26) |
| InChIKey | AVYQPRZFCWLGEH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|