C17H26ClN3O2 — CID 97167658
tert-butyl (3R)-3-[[(6-chloro-3-pyridinyl)methyl-methylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 97167658) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(6-chloro-3-pyridinyl)methyl-methylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(6-chloro-3-pyridinyl)methyl-methylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97167658 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl (3R)-3-[[(6-chloro-3-pyridinyl)methyl-methylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(Cc1ccc(Cl)nc1)C[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-17(2,3)23-16(22)21-8-7-14(12-21)11-20(4)10-13-5-6-15(18)19-9-13/h5-6,9,14H,7-8,10-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | UAQCJQHYQYKHIG-CQSZACIVSA-N |
| XLogP | 3.42 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|