C19H29ClN2O3 — CID 97172086
tert-butyl (3R)-3-[3-[(6-chloro-3-pyridinyl)methoxy]propyl]piperidine-1-carboxylate (PubChem CID 97172086) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-[(6-chloro-3-pyridinyl)methoxy]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-[(6-chloro-3-pyridinyl)methoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172086 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | tert-butyl (3R)-3-[3-[(6-chloro-3-pyridinyl)methoxy]propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CCCOCc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C19H29ClN2O3/c1-19(2,3)25-18(23)22-10-4-6-15(13-22)7-5-11-24-14-16-8-9-17(20)21-12-16/h8-9,12,15H,4-7,10-11,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | WOELEBWFOMVZLJ-OAHLLOKOSA-N |
| XLogP | 4.68 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|