C16H26ClN3O2 — CID 107445970
tert-butyl N-tert-butyl-N-[2-[(6-chloro-3-pyridinyl)amino]ethyl]carbamate (PubChem CID 107445970) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[(6-chloro-3-pyridinyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[(6-chloro-3-pyridinyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107445970 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[(6-chloro-3-pyridinyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNc1ccc(Cl)nc1)C(C)(C)C |
| InChI | InChI=1S/C16H26ClN3O2/c1-15(2,3)20(14(21)22-16(4,5)6)10-9-18-12-7-8-13(17)19-11-12/h7-8,11,18H,9-10H2,1-6H3 |
| InChIKey | ONXVWQROAKUXBJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|