C15H32N2O2 — CID 107444428
tert-butyl N-tert-butyl-N-[2-(tert-butylamino)ethyl]carbamate (PubChem CID 107444428) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(tert-butylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(tert-butylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107444428 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(tert-butylamino)ethyl]carbamate |
| SMILES | CC(C)(C)NCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O2/c1-13(2,3)16-10-11-17(14(4,5)6)12(18)19-15(7,8)9/h16H,10-11H2,1-9H3 |
| InChIKey | RKOCJVUDGIAJBW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |