C14H30N2O4 — CID 107445990
tert-butyl N-tert-butyl-N-[2-(2-methoxyethoxyamino)ethyl]carbamate (PubChem CID 107445990) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(2-methoxyethoxyamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(2-methoxyethoxyamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107445990 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(2-methoxyethoxyamino)ethyl]carbamate |
| SMILES | COCCONCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O4/c1-13(2,3)16(12(17)20-14(4,5)6)9-8-15-19-11-10-18-7/h15H,8-11H2,1-7H3 |
| InChIKey | LZQGIGWVZYOJNH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|