C15H32N2O4 — CID 107445688
tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-3-methoxypropyl)amino]ethyl]carbamate (PubChem CID 107445688) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-3-methoxypropyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-3-methoxypropyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107445688 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-3-methoxypropyl)amino]ethyl]carbamate |
| SMILES | COCC(O)CNCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32N2O4/c1-14(2,3)17(13(19)21-15(4,5)6)9-8-16-10-12(18)11-20-7/h12,16,18H,8-11H2,1-7H3 |
| InChIKey | KWMGPUGWXJUKOR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|