C14H30N2O4S — CID 107445324
tert-butyl N-tert-butyl-N-[2-(2-methylsulfonylethylamino)ethyl]carbamate (PubChem CID 107445324) has the molecular formula C14H30N2O4S and a molecular weight of 322.47 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(2-methylsulfonylethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(2-methylsulfonylethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107445324 |
| Molecular Formula | C14H30N2O4S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(2-methylsulfonylethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNCCS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O4S/c1-13(2,3)16(12(17)20-14(4,5)6)10-8-15-9-11-21(7,18)19/h15H,8-11H2,1-7H3 |
| InChIKey | CGKFPUHVJAKJOG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|