C17H37N3O3 — CID 106144990
tert-butyl N-tert-butyl-N-[2-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]ethyl]carbamate (PubChem CID 106144990) has the molecular formula C17H37N3O3 and a molecular weight of 331.50 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 106144990 |
| Molecular Formula | C17H37N3O3 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.28 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]ethyl]carbamate |
| SMILES | CN(C)CC(C)(O)CNCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H37N3O3/c1-15(2,3)20(14(21)23-16(4,5)6)11-10-18-12-17(7,22)13-19(8)9/h18,22H,10-13H2,1-9H3 |
| InChIKey | HIQRFTGRCNWHQX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|