C18H38N2O3 — CID 106144008
tert-butyl N-tert-butyl-N-[2-[(5-hydroxy-2,2-dimethylpentyl)amino]ethyl]carbamate (PubChem CID 106144008) has the molecular formula C18H38N2O3 and a molecular weight of 330.51 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[(5-hydroxy-2,2-dimethylpentyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[(5-hydroxy-2,2-dimethylpentyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 106144008 |
| Molecular Formula | C18H38N2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[(5-hydroxy-2,2-dimethylpentyl)amino]ethyl]carbamate |
| SMILES | CC(C)(CCCO)CNCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38N2O3/c1-16(2,3)20(15(22)23-17(4,5)6)12-11-19-14-18(7,8)10-9-13-21/h19,21H,9-14H2,1-8H3 |
| InChIKey | PQNGVXRQCUCMIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|