C17H30N2O3S — CID 106434713
tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]carbamate (PubChem CID 106434713) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 106434713 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNCC(O)c1ccsc1)C(C)(C)C |
| InChI | InChI=1S/C17H30N2O3S/c1-16(2,3)19(15(21)22-17(4,5)6)9-8-18-11-14(20)13-7-10-23-12-13/h7,10,12,14,18,20H,8-9,11H2,1-6H3 |
| InChIKey | XQZHUPYBLKIZTK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|