C15H28N2O2 — CID 107446234
tert-butyl N-tert-butyl-N-[2-(but-3-yn-2-ylamino)ethyl]carbamate (PubChem CID 107446234) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(but-3-yn-2-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(but-3-yn-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107446234 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(but-3-yn-2-ylamino)ethyl]carbamate |
| SMILES | C#CC(C)NCCN(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-9-12(2)16-10-11-17(14(3,4)5)13(18)19-15(6,7)8/h1,12,16H,10-11H2,2-8H3 |
| InChIKey | NAKKYOJFCKCQBT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|