C14H28N6O2 — CID 107445532
tert-butyl N-tert-butyl-N-[2-[1-(2H-tetrazol-5-yl)ethylamino]ethyl]carbamate (PubChem CID 107445532) has the molecular formula C14H28N6O2 and a molecular weight of 312.42 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-[1-(2H-tetrazol-5-yl)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-[1-(2H-tetrazol-5-yl)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107445532 |
| Molecular Formula | C14H28N6O2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-[1-(2H-tetrazol-5-yl)ethylamino]ethyl]carbamate |
| SMILES | CC(NCCN(C(=O)OC(C)(C)C)C(C)(C)C)c1nn[nH]n1 |
| InChI | InChI=1S/C14H28N6O2/c1-10(11-16-18-19-17-11)15-8-9-20(13(2,3)4)12(21)22-14(5,6)7/h10,15H,8-9H2,1-7H3,(H,16,17,18,19) |
| InChIKey | ARECSWSXJHXHIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |