C14H26N4O2 — CID 107444832
tert-butyl N-tert-butyl-N-[2-(1H-pyrazol-4-ylamino)ethyl]carbamate (PubChem CID 107444832) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(1H-pyrazol-4-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(1H-pyrazol-4-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107444832 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(1H-pyrazol-4-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNc1cn[nH]c1)C(C)(C)C |
| InChI | InChI=1S/C14H26N4O2/c1-13(2,3)18(12(19)20-14(4,5)6)8-7-15-11-9-16-17-10-11/h9-10,15H,7-8H2,1-6H3,(H,16,17) |
| InChIKey | KAWSYYBEOOPPRN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |