C14H26N4O2 — CID 107441366
tert-butyl N-[3-methyl-2-[(1H-pyrazol-4-ylamino)methyl]butyl]carbamate (PubChem CID 107441366) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[(1H-pyrazol-4-ylamino)methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[(1H-pyrazol-4-ylamino)methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107441366 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[(1H-pyrazol-4-ylamino)methyl]butyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)CNc1cn[nH]c1 |
| InChI | InChI=1S/C14H26N4O2/c1-10(2)11(6-15-12-8-17-18-9-12)7-16-13(19)20-14(3,4)5/h8-11,15H,6-7H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | BHLMDIYWFBIHRQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |