C16H30N4O2 — CID 107442814
tert-butyl N-[2-[[2-(1H-imidazol-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate (PubChem CID 107442814) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(1H-imidazol-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(1H-imidazol-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107442814 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(1H-imidazol-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNCCc1ncc[nH]1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O2/c1-12(2)13(11-20-15(21)22-16(3,4)5)10-17-7-6-14-18-8-9-19-14/h8-9,12-13,17H,6-7,10-11H2,1-5H3,(H,18,19)(H,20,21) |
| InChIKey | TWSRLFJJESRCIH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|