C14H31N3O4S — CID 107442111
tert-butyl N-[3-methyl-2-[(3-sulfamoylpropylamino)methyl]butyl]carbamate (PubChem CID 107442111) has the molecular formula C14H31N3O4S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[(3-sulfamoylpropylamino)methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[(3-sulfamoylpropylamino)methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107442111 |
| Molecular Formula | C14H31N3O4S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[(3-sulfamoylpropylamino)methyl]butyl]carbamate |
| SMILES | CC(C)C(CNCCCS(N)(=O)=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H31N3O4S/c1-11(2)12(9-16-7-6-8-22(15,19)20)10-17-13(18)21-14(3,4)5/h11-12,16H,6-10H2,1-5H3,(H,17,18)(H2,15,19,20) |
| InChIKey | ZYKDNIYDSYBBJL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|