C17H35N3O3 — CID 107442562
tert-butyl N-[2-[[[2-(tert-butylamino)-2-oxoethyl]amino]methyl]-3-methylbutyl]carbamate (PubChem CID 107442562) has the molecular formula C17H35N3O3 and a molecular weight of 329.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[[2-(tert-butylamino)-2-oxoethyl]amino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[2-(tert-butylamino)-2-oxoethyl]amino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107442562 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | tert-butyl N-[2-[[[2-(tert-butylamino)-2-oxoethyl]amino]methyl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNCC(=O)NC(C)(C)C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35N3O3/c1-12(2)13(10-19-15(22)23-17(6,7)8)9-18-11-14(21)20-16(3,4)5/h12-13,18H,9-11H2,1-8H3,(H,19,22)(H,20,21) |
| InChIKey | VCPDBOHZVJOXTC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |