C16H32N2O4 — CID 107442125
ethyl 3-[[3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]amino]propanoate (PubChem CID 107442125) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl 3-[[3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]amino]propanoate.
| Compound Name | ethyl 3-[[3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]amino]propanoate |
|---|---|
| PubChem CID | 107442125 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | ethyl 3-[[3-methyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]amino]propanoate |
| SMILES | CCOC(=O)CCNCC(CNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32N2O4/c1-7-21-14(19)8-9-17-10-13(12(2)3)11-18-15(20)22-16(4,5)6/h12-13,17H,7-11H2,1-6H3,(H,18,20) |
| InChIKey | ZRDZTUJRLFQWEE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|