C18H39N3O2 — CID 107441056
tert-butyl N-[2-[[3-(diethylamino)propylamino]methyl]-3-methylbutyl]carbamate (PubChem CID 107441056) has the molecular formula C18H39N3O2 and a molecular weight of 329.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(diethylamino)propylamino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(diethylamino)propylamino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107441056 |
| Molecular Formula | C18H39N3O2 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.30 |
| IUPAC Name | tert-butyl N-[2-[[3-(diethylamino)propylamino]methyl]-3-methylbutyl]carbamate |
| SMILES | CCN(CC)CCCNCC(CNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H39N3O2/c1-8-21(9-2)12-10-11-19-13-16(15(3)4)14-20-17(22)23-18(5,6)7/h15-16,19H,8-14H2,1-7H3,(H,20,22) |
| InChIKey | SMOOVFKJOBUQAV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|