C15H29N5O2 — CID 107442304
tert-butyl N-[3-methyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butyl]carbamate (PubChem CID 107442304) has the molecular formula C15H29N5O2 and a molecular weight of 311.43 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107442304 |
| Molecular Formula | C15H29N5O2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[[2-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]butyl]carbamate |
| SMILES | CC(C)C(CNCCc1ncn[nH]1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N5O2/c1-11(2)12(9-17-14(21)22-15(3,4)5)8-16-7-6-13-18-10-19-20-13/h10-12,16H,6-9H2,1-5H3,(H,17,21)(H,18,19,20) |
| InChIKey | PWXGHTGNZWGPBW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|