C14H20ClN3S — CID 143485026
N'-[(6-chloro-3-pyridinyl)methyl]-N-(1-methylsulfanylethenyl)-N'-prop-2-enylethane-1,2-diamine (PubChem CID 143485026) has the molecular formula C14H20ClN3S and a molecular weight of 297.86 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)methyl]-N-(1-methylsulfanylethenyl)-N'-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-(1-methylsulfanylethenyl)-N'-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 143485026 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)methyl]-N-(1-methylsulfanylethenyl)-N'-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCN(CCNC(=C)SC)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H20ClN3S/c1-4-8-18(9-7-16-12(2)19-3)11-13-5-6-14(15)17-10-13/h4-6,10,16H,1-2,7-9,11H2,3H3 |
| InChIKey | RBAPQZJGBYTLDM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|