C21H33ClN2OSi — CID 140842131
4-[[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-ethylamino]-2-chlorobenzonitrile (PubChem CID 140842131) has the molecular formula C21H33ClN2OSi and a molecular weight of 393.05 g/mol. Its IUPAC name is 4-[[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-ethylamino]-2-chlorobenzonitrile.
| Compound Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-ethylamino]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 140842131 |
| Molecular Formula | C21H33ClN2OSi |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-ethylamino]-2-chlorobenzonitrile |
| SMILES | CCN(c1ccc(C#N)c(Cl)c1)C1CCCC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H33ClN2OSi/c1-7-24(18-12-11-16(15-23)20(22)14-18)17-9-8-10-19(13-17)25-26(5,6)21(2,3)4/h11-12,14,17,19H,7-10,13H2,1-6H3 |
| InChIKey | KKUWTXXALVSFAQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|