C21H28ClN3O — CID 143704263
2-chloro-4-[cyclobutylmethyl-(1-methylpyrrolidin-3-yl)amino]benzonitrile;cyclopropanecarbaldehyde (PubChem CID 143704263) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 2-chloro-4-[cyclobutylmethyl-(1-methylpyrrolidin-3-yl)amino]benzonitrile;cyclopropanecarbaldehyde.
| Compound Name | 2-chloro-4-[cyclobutylmethyl-(1-methylpyrrolidin-3-yl)amino]benzonitrile;cyclopropanecarbaldehyde |
|---|---|
| PubChem CID | 143704263 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-chloro-4-[cyclobutylmethyl-(1-methylpyrrolidin-3-yl)amino]benzonitrile;cyclopropanecarbaldehyde |
| SMILES | CN1CCC(N(CC2CCC2)c2ccc(C#N)c(Cl)c2)C1.O=CC1CC1 |
| InChI | InChI=1S/C17H22ClN3.C4H6O/c1-20-8-7-16(12-20)21(11-13-3-2-4-13)15-6-5-14(10-19)17(18)9-15;5-3-4-1-2-4/h5-6,9,13,16H,2-4,7-8,11-12H2,1H3;3-4H,1-2H2 |
| InChIKey | QBVPXSSVZWBFDS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|