C19H16Cl3N3O — CID 143704449
2-chloro-4-[(2,5-dichlorophenyl)methyl-(1-formylpyrrolidin-3-yl)amino]benzonitrile (PubChem CID 143704449) has the molecular formula C19H16Cl3N3O and a molecular weight of 408.72 g/mol. Its IUPAC name is 2-chloro-4-[(2,5-dichlorophenyl)methyl-(1-formylpyrrolidin-3-yl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[(2,5-dichlorophenyl)methyl-(1-formylpyrrolidin-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 143704449 |
| Molecular Formula | C19H16Cl3N3O |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 2-chloro-4-[(2,5-dichlorophenyl)methyl-(1-formylpyrrolidin-3-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(N(Cc2cc(Cl)ccc2Cl)C2CCN(C=O)C2)cc1Cl |
| InChI | InChI=1S/C19H16Cl3N3O/c20-15-2-4-18(21)14(7-15)10-25(17-5-6-24(11-17)12-26)16-3-1-13(9-23)19(22)8-16/h1-4,7-8,12,17H,5-6,10-11H2 |
| InChIKey | FZLXCWUVFCNCLL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|