C27H36ClN3O2 — CID 143704465
2-chloro-4-[(1-formylpyrrolidin-3-yl)-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl]amino]benzonitrile;1-methylcyclohexan-1-ol (PubChem CID 143704465) has the molecular formula C27H36ClN3O2 and a molecular weight of 470.06 g/mol. Its IUPAC name is 2-chloro-4-[(1-formylpyrrolidin-3-yl)-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl]amino]benzonitrile;1-methylcyclohexan-1-ol.
| Compound Name | 2-chloro-4-[(1-formylpyrrolidin-3-yl)-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl]amino]benzonitrile;1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 143704465 |
| Molecular Formula | C27H36ClN3O2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-chloro-4-[(1-formylpyrrolidin-3-yl)-[(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl]amino]benzonitrile;1-methylcyclohexan-1-ol |
| SMILES | C=C/C=C(/CN(c1ccc(C#N)c(Cl)c1)C1CCN(C=O)C1)C(=C)C.CC1(O)CCCCC1 |
| InChI | InChI=1S/C20H22ClN3O.C7H14O/c1-4-5-17(15(2)3)12-24(19-8-9-23(13-19)14-25)18-7-6-16(11-22)20(21)10-18;1-7(8)5-3-2-4-6-7/h4-7,10,14,19H,1-2,8-9,12-13H2,3H3;8H,2-6H2,1H3/b17-5-; |
| InChIKey | XNFAOWHRKPLKDU-PXQSGXIUSA-N |
| XLogP | 5.64 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|