C18H22ClN3O2 — CID 68802581
(3S)-3-[3-chloro-4-cyano-N-(cyclopentylmethyl)anilino]pyrrolidine-1-carboxylic acid (PubChem CID 68802581) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is (3S)-3-[3-chloro-4-cyano-N-(cyclopentylmethyl)anilino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-[3-chloro-4-cyano-N-(cyclopentylmethyl)anilino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68802581 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (3S)-3-[3-chloro-4-cyano-N-(cyclopentylmethyl)anilino]pyrrolidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(N(CC2CCCC2)[C@H]2CCN(C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C18H22ClN3O2/c19-17-9-15(6-5-14(17)10-20)22(11-13-3-1-2-4-13)16-7-8-21(12-16)18(23)24/h5-6,9,13,16H,1-4,7-8,11-12H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | ONGZLYXORFEMPM-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |