C14H16ClNO — CID 58587579
2-chloro-4-[(1R,3R)-3-methylcyclohexyl]oxybenzonitrile (PubChem CID 58587579) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 2-chloro-4-[(1R,3R)-3-methylcyclohexyl]oxybenzonitrile.
| Compound Name | 2-chloro-4-[(1R,3R)-3-methylcyclohexyl]oxybenzonitrile |
|---|---|
| PubChem CID | 58587579 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-chloro-4-[(1R,3R)-3-methylcyclohexyl]oxybenzonitrile |
| SMILES | C[C@@H]1CCC[C@@H](Oc2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H16ClNO/c1-10-3-2-4-12(7-10)17-13-6-5-11(9-16)14(15)8-13/h5-6,8,10,12H,2-4,7H2,1H3/t10-,12-/m1/s1 |
| InChIKey | KBMRULHOGNJDSK-ZYHUDNBSSA-N |
| XLogP | 4.17 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |