C17H18ClN3OS — CID 134413709
2-chloro-4-[4-(1-methyl-5-sulfanylimidazol-2-yl)cyclohexyl]oxybenzonitrile (PubChem CID 134413709) has the molecular formula C17H18ClN3OS and a molecular weight of 347.87 g/mol. Its IUPAC name is 2-chloro-4-[4-(1-methyl-5-sulfanylimidazol-2-yl)cyclohexyl]oxybenzonitrile.
| Compound Name | 2-chloro-4-[4-(1-methyl-5-sulfanylimidazol-2-yl)cyclohexyl]oxybenzonitrile |
|---|---|
| PubChem CID | 134413709 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-chloro-4-[4-(1-methyl-5-sulfanylimidazol-2-yl)cyclohexyl]oxybenzonitrile |
| SMILES | Cn1c(S)cnc1C1CCC(Oc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H18ClN3OS/c1-21-16(23)10-20-17(21)11-2-5-13(6-3-11)22-14-7-4-12(9-19)15(18)8-14/h4,7-8,10-11,13,23H,2-3,5-6H2,1H3 |
| InChIKey | CDXAMHJGUKCMND-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|