C13H11ClIN3O — CID 89224664
2-chloro-4-[(3-cyclopropyl-5-iodo-4,5-dihydro-1H-pyrazol-4-yl)oxy]benzonitrile (PubChem CID 89224664) has the molecular formula C13H11ClIN3O and a molecular weight of 387.61 g/mol. Its IUPAC name is 2-chloro-4-[(3-cyclopropyl-5-iodo-4,5-dihydro-1H-pyrazol-4-yl)oxy]benzonitrile.
| Compound Name | 2-chloro-4-[(3-cyclopropyl-5-iodo-4,5-dihydro-1H-pyrazol-4-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 89224664 |
| Molecular Formula | C13H11ClIN3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 2-chloro-4-[(3-cyclopropyl-5-iodo-4,5-dihydro-1H-pyrazol-4-yl)oxy]benzonitrile |
| SMILES | N#Cc1ccc(OC2C(C3CC3)=NNC2I)cc1Cl |
| InChI | InChI=1S/C13H11ClIN3O/c14-10-5-9(4-3-8(10)6-16)19-12-11(7-1-2-7)17-18-13(12)15/h3-5,7,12-13,18H,1-2H2 |
| InChIKey | SRMBKUABWBUIPS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|