C15H17ClINO — CID 163531856
2-chloro-4-(3-iodo-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile (PubChem CID 163531856) has the molecular formula C15H17ClINO and a molecular weight of 389.66 g/mol. Its IUPAC name is 2-chloro-4-(3-iodo-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile.
| Compound Name | 2-chloro-4-(3-iodo-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile |
|---|---|
| PubChem CID | 163531856 |
| Molecular Formula | C15H17ClINO |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2-chloro-4-(3-iodo-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile |
| SMILES | CC1(C)C(I)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClINO/c1-14(2)12(17)15(3,4)13(14)19-10-6-5-9(8-18)11(16)7-10/h5-7,12-13H,1-4H3 |
| InChIKey | GGTDGJXZKRJZCP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|