C23H24ClIN2O2 — CID 155671665
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(deuteriomethyl)-4-iodobenzamide (PubChem CID 155671665) has the molecular formula C23H24ClIN2O2 and a molecular weight of 523.82 g/mol. Its IUPAC name is N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(deuteriomethyl)-4-iodobenzamide.
| Compound Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(deuteriomethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 155671665 |
| Molecular Formula | C23H24ClIN2O2 |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(deuteriomethyl)-4-iodobenzamide |
| SMILES | [2H]CN(C(=O)c1ccc(I)cc1)C1C(C)(C)C(Oc2ccc(C#N)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C23H24ClIN2O2/c1-22(2)20(27(5)19(28)14-6-9-16(25)10-7-14)23(3,4)21(22)29-17-11-8-15(13-26)18(24)12-17/h6-12,20-21H,1-5H3/i5D |
| InChIKey | SSEPEWTULWTDJJ-UICOGKGYSA-N |
| XLogP | 5.77 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|