C22H23BrClN3O2 — CID 167417333
6-bromo-N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(trideuteriomethyl)pyridine-3-carboxamide (PubChem CID 167417333) has the molecular formula C22H23BrClN3O2 and a molecular weight of 479.82 g/mol. Its IUPAC name is 6-bromo-N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(trideuteriomethyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(trideuteriomethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167417333 |
| Molecular Formula | C22H23BrClN3O2 |
| Molecular Weight | 479.82 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 6-bromo-N-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-N-(trideuteriomethyl)pyridine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)c1ccc(Br)nc1)C1C(C)(C)C(Oc2ccc([N+]#[C-])c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C22H23BrClN3O2/c1-21(2)19(27(6)18(28)13-7-10-17(23)26-12-13)22(3,4)20(21)29-14-8-9-16(25-5)15(24)11-14/h7-12,19-20H,1-4,6H3/i6D3 |
| InChIKey | NKFDURQFEHVULL-UNLAWSRZSA-N |
| XLogP | 6.00 |
| TPSA | 46.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.82 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|