C26H31ClN4O2 — CID 157299397
2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-(6-piperazin-1-yl-3-pyridinyl)ethanone (PubChem CID 157299397) has the molecular formula C26H31ClN4O2 and a molecular weight of 467.01 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-(6-piperazin-1-yl-3-pyridinyl)ethanone.
| Compound Name | 2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-(6-piperazin-1-yl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157299397 |
| Molecular Formula | C26H31ClN4O2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[3-(3-chloro-4-isocyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-1-(6-piperazin-1-yl-3-pyridinyl)ethanone |
| SMILES | [C-]#[N+]c1ccc(OC2C(C)(C)C(CC(=O)c3ccc(N4CCNCC4)nc3)C2(C)C)cc1Cl |
| InChI | InChI=1S/C26H31ClN4O2/c1-25(2)22(26(3,4)24(25)33-18-7-8-20(28-5)19(27)14-18)15-21(32)17-6-9-23(30-16-17)31-12-10-29-11-13-31/h6-9,14,16,22,24,29H,10-13,15H2,1-4H3 |
| InChIKey | SNQKSBBIWXYCHO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|